About N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxamide
N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxamide (PubChem CID 154805508) has the molecular formula C15H20FN3O
and a molecular weight of 277.34 g/mol. Its IUPAC name is N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxamide.
Molecular Properties
| Compound Name | N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxamide |
| PubChem CID | 154805508 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxamide |
| SMILES | O=C(NC12CCC(F)(CC1)CC2)c1cc2n(n1)CCC2 |
| InChI | InChI=1S/C15H20FN3O/c16-14-3-6-15(7-4-14,8-5-14)17-13(20)12-10-11-2-1-9-19(11)18-12/h10H,1-9H2,(H,17,20) |
| InChIKey | LTJXCMZFTMOHMS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxamide?
The IUPAC name of N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxamide (CID 154805508) is N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxamide.
What is the SMILES notation for N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxamide?
The canonical SMILES for N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxamide is O=C(NC12CCC(F)(CC1)CC2)c1cc2n(n1)CCC2.
What is the InChIKey of N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxamide?
The InChIKey is LTJXCMZFTMOHMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FN3O/c16-14-3-6-15(7-4-14,8-5-14)17-13(20)12-10-11-2-1-9-19(11)18-12/h10H,1-9H2,(H,17,20).
What are the key properties of N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxamide?
N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxamide has a molecular weight of 277.34 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxamide is sourced from PubChem (CID 154805508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).