C19H27N3O — CID 154806034
(3aR,6aS)-5-methoxy-N-[2-(2-methylbenzimidazol-1-yl)ethyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-amine (PubChem CID 154806034) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is (3aR,6aS)-5-methoxy-N-[2-(2-methylbenzimidazol-1-yl)ethyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-amine.
| Compound Name | (3aR,6aS)-5-methoxy-N-[2-(2-methylbenzimidazol-1-yl)ethyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-amine |
|---|---|
| PubChem CID | 154806034 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | (3aR,6aS)-5-methoxy-N-[2-(2-methylbenzimidazol-1-yl)ethyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-amine |
| SMILES | COC1C[C@H]2CC(NCCn3c(C)nc4ccccc43)C[C@H]2C1 |
| InChI | InChI=1S/C19H27N3O/c1-13-21-18-5-3-4-6-19(18)22(13)8-7-20-16-9-14-11-17(23-2)12-15(14)10-16/h3-6,14-17,20H,7-12H2,1-2H3/t14-,15+,16?,17? |
| InChIKey | DBQXFMLXLUAXIJ-RYTJFDOTSA-N |
| XLogP | 3.14 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |