C18H19BrN4O2 — CID 154806372
1-[1-[1-[[5-(4-bromophenyl)furan-2-yl]methyl]azetidin-3-yl]triazol-4-yl]ethanol (PubChem CID 154806372) has the molecular formula C18H19BrN4O2 and a molecular weight of 403.28 g/mol. Its IUPAC name is 1-[1-[1-[[5-(4-bromophenyl)furan-2-yl]methyl]azetidin-3-yl]triazol-4-yl]ethanol.
| Compound Name | 1-[1-[1-[[5-(4-bromophenyl)furan-2-yl]methyl]azetidin-3-yl]triazol-4-yl]ethanol |
|---|---|
| PubChem CID | 154806372 |
| Molecular Formula | C18H19BrN4O2 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 1-[1-[1-[[5-(4-bromophenyl)furan-2-yl]methyl]azetidin-3-yl]triazol-4-yl]ethanol |
| SMILES | CC(O)c1cn(C2CN(Cc3ccc(-c4ccc(Br)cc4)o3)C2)nn1 |
| InChI | InChI=1S/C18H19BrN4O2/c1-12(24)17-11-23(21-20-17)15-8-22(9-15)10-16-6-7-18(25-16)13-2-4-14(19)5-3-13/h2-7,11-12,15,24H,8-10H2,1H3 |
| InChIKey | YEYXJHMKWDDJDL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |