C22H27N3O2 — CID 154806489
N-[(1R,2R)-2-(3-pyridin-3-ylbutanoylamino)cyclohexyl]benzamide (PubChem CID 154806489) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[(1R,2R)-2-(3-pyridin-3-ylbutanoylamino)cyclohexyl]benzamide.
| Compound Name | N-[(1R,2R)-2-(3-pyridin-3-ylbutanoylamino)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 154806489 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-[(1R,2R)-2-(3-pyridin-3-ylbutanoylamino)cyclohexyl]benzamide |
| SMILES | CC(CC(=O)N[C@@H]1CCCC[C@H]1NC(=O)c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C22H27N3O2/c1-16(18-10-7-13-23-15-18)14-21(26)24-19-11-5-6-12-20(19)25-22(27)17-8-3-2-4-9-17/h2-4,7-10,13,15-16,19-20H,5-6,11-12,14H2,1H3,(H,24,26)(H,25,27)/t16?,19-,20-/m1/s1 |
| InChIKey | GPNAMXOZASGAIF-ODFWGIBRSA-N |
| XLogP | 3.43 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |