C18H27N3O — CID 154807276
(1S,5S)-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylmethyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine (PubChem CID 154807276) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is (1S,5S)-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylmethyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine.
| Compound Name | (1S,5S)-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylmethyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine |
|---|---|
| PubChem CID | 154807276 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | (1S,5S)-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylmethyl)spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine |
| SMILES | c1cn2c(n1)CC(CNC1[C@@H]3CCO[C@@H]3C13CCCC3)CC2 |
| InChI | InChI=1S/C18H27N3O/c1-2-6-18(5-1)16(14-4-10-22-17(14)18)20-12-13-3-8-21-9-7-19-15(21)11-13/h7,9,13-14,16-17,20H,1-6,8,10-12H2/t13?,14-,16?,17-/m0/s1 |
| InChIKey | ZTQBUNOWAKASKK-VLVHBFOGSA-N |
| XLogP | 2.38 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |