C15H16BN3O3 — CID 154807559
1-hydroxy-N-[(1R,2R)-2-(3-methylimidazol-4-yl)cyclopropyl]-3H-2,1-benzoxaborole-5-carboxamide (PubChem CID 154807559) has the molecular formula C15H16BN3O3 and a molecular weight of 297.12 g/mol. Its IUPAC name is 1-hydroxy-N-[(1R,2R)-2-(3-methylimidazol-4-yl)cyclopropyl]-3H-2,1-benzoxaborole-5-carboxamide.
| Compound Name | 1-hydroxy-N-[(1R,2R)-2-(3-methylimidazol-4-yl)cyclopropyl]-3H-2,1-benzoxaborole-5-carboxamide |
|---|---|
| PubChem CID | 154807559 |
| Molecular Formula | C15H16BN3O3 |
| Molecular Weight | 297.12 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-hydroxy-N-[(1R,2R)-2-(3-methylimidazol-4-yl)cyclopropyl]-3H-2,1-benzoxaborole-5-carboxamide |
| SMILES | Cn1cncc1[C@@H]1C[C@H]1NC(=O)c1ccc2c(c1)COB2O |
| InChI | InChI=1S/C15H16BN3O3/c1-19-8-17-6-14(19)11-5-13(11)18-15(20)9-2-3-12-10(4-9)7-22-16(12)21/h2-4,6,8,11,13,21H,5,7H2,1H3,(H,18,20)/t11-,13-/m1/s1 |
| InChIKey | CLNJNKAYNHWGCY-DGCLKSJQSA-N |
| XLogP | -0.08 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.12 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|