C20H28O5 — CID 15480774
(4bS,8aS,10R)-1,10-dihydroxy-2-(1-hydroxypropan-2-yl)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-3,4-dione (PubChem CID 15480774) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (4bS,8aS,10R)-1,10-dihydroxy-2-(1-hydroxypropan-2-yl)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-3,4-dione.
| Compound Name | (4bS,8aS,10R)-1,10-dihydroxy-2-(1-hydroxypropan-2-yl)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-3,4-dione |
|---|---|
| PubChem CID | 15480774 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (4bS,8aS,10R)-1,10-dihydroxy-2-(1-hydroxypropan-2-yl)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-3,4-dione |
| SMILES | CC(CO)C1=C(O)C2=C(C(=O)C1=O)[C@@]1(C)CCCC(C)(C)[C@@H]1C[C@H]2O |
| InChI | InChI=1S/C20H28O5/c1-10(9-21)13-16(23)14-11(22)8-12-19(2,3)6-5-7-20(12,4)15(14)18(25)17(13)24/h10-12,21-23H,5-9H2,1-4H3/t10?,11-,12+,20+/m1/s1 |
| InChIKey | CCJCYDFCTMDYFU-NBHQDKSLSA-N |
| XLogP | 2.47 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|