C16H18FN3O2 — CID 154807955
1-[(6-fluoro-1,2-benzoxazol-3-yl)methyl]-3-[(1R,6R)-6-methylcyclohex-3-en-1-yl]urea (PubChem CID 154807955) has the molecular formula C16H18FN3O2 and a molecular weight of 303.34 g/mol. Its IUPAC name is 1-[(6-fluoro-1,2-benzoxazol-3-yl)methyl]-3-[(1R,6R)-6-methylcyclohex-3-en-1-yl]urea.
| Compound Name | 1-[(6-fluoro-1,2-benzoxazol-3-yl)methyl]-3-[(1R,6R)-6-methylcyclohex-3-en-1-yl]urea |
|---|---|
| PubChem CID | 154807955 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1-[(6-fluoro-1,2-benzoxazol-3-yl)methyl]-3-[(1R,6R)-6-methylcyclohex-3-en-1-yl]urea |
| SMILES | C[C@@H]1CC=CC[C@H]1NC(=O)NCc1noc2cc(F)ccc12 |
| InChI | InChI=1S/C16H18FN3O2/c1-10-4-2-3-5-13(10)19-16(21)18-9-14-12-7-6-11(17)8-15(12)22-20-14/h2-3,6-8,10,13H,4-5,9H2,1H3,(H2,18,19,21)/t10-,13-/m1/s1 |
| InChIKey | AOAZSLJSJGKRIR-ZWNOBZJWSA-N |
| XLogP | 3.12 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|