C25H20N4O5S — CID 154808161
2-[(1S,2R,6R,7S,8R,12S)-5-(3-nitrophenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 154808161) has the molecular formula C25H20N4O5S and a molecular weight of 488.53 g/mol. Its IUPAC name is 2-[(1S,2R,6R,7S,8R,12S)-5-(3-nitrophenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-[(1S,2R,6R,7S,8R,12S)-5-(3-nitrophenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 154808161 |
| Molecular Formula | C25H20N4O5S |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 2-[(1S,2R,6R,7S,8R,12S)-5-(3-nitrophenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | N#Cc1c(N2C(=O)[C@@H]3[C@H]4C[C@H]([C@H]5ON=C(c6cccc([N+](=O)[O-])c6)[C@@H]45)[C@@H]3C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C25H20N4O5S/c26-10-16-13-6-1-2-7-17(13)35-25(16)28-23(30)18-14-9-15(19(18)24(28)31)22-20(14)21(27-34-22)11-4-3-5-12(8-11)29(32)33/h3-5,8,14-15,18-20,22H,1-2,6-7,9H2/t14-,15+,18-,19+,20-,22-/m1/s1 |
| InChIKey | BOGPDTNBBYAQKN-VLSUTZIASA-N |
| XLogP | 3.58 |
| TPSA | 125.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|