C20H23N3OS — CID 154808315
(1S,9S)-6-oxo-N-(1-phenylethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide (PubChem CID 154808315) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is (1S,9S)-6-oxo-N-(1-phenylethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide.
| Compound Name | (1S,9S)-6-oxo-N-(1-phenylethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide |
|---|---|
| PubChem CID | 154808315 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (1S,9S)-6-oxo-N-(1-phenylethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbothioamide |
| SMILES | CC(NC(=S)N1C[C@H]2C[C@@H](C1)c1cccc(=O)n1C2)c1ccccc1 |
| InChI | InChI=1S/C20H23N3OS/c1-14(16-6-3-2-4-7-16)21-20(25)22-11-15-10-17(13-22)18-8-5-9-19(24)23(18)12-15/h2-9,14-15,17H,10-13H2,1H3,(H,21,25)/t14?,15-,17+/m1/s1 |
| InChIKey | ZEPQNJVMALSOEX-LBVBGPOBSA-N |
| XLogP | 2.90 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|