C20H27N2O+ — CID 154809049
[(10R,11R,12E)-12-ethylidene-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-trien-10-yl]methanol (PubChem CID 154809049) has the molecular formula C20H27N2O+ and a molecular weight of 311.45 g/mol. Its IUPAC name is [(10R,11R,12E)-12-ethylidene-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-trien-10-yl]methanol.
| Compound Name | [(10R,11R,12E)-12-ethylidene-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-trien-10-yl]methanol |
|---|---|
| PubChem CID | 154809049 |
| Molecular Formula | C20H27N2O+ |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | [(10R,11R,12E)-12-ethylidene-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6-trien-10-yl]methanol |
| SMILES | C/C=C1/C[N+]2(C)CCC34c5ccccc5NC3[C@H](CO)[C@H]1CC42 |
| InChI | InChI=1S/C20H27N2O/c1-3-13-11-22(2)9-8-20-16-6-4-5-7-17(16)21-19(20)15(12-23)14(13)10-18(20)22/h3-7,14-15,18-19,21,23H,8-12H2,1-2H3/q+1/b13-3-/t14-,15+,18?,19?,20?,22?/m0/s1 |
| InChIKey | LKZQOCJBJKPRFV-VCQIQVPRSA-N |
| XLogP | 2.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|