About (2,5-dichlorothiophen-3-yl)methanamine;dihydrochloride
(2,5-dichlorothiophen-3-yl)methanamine;dihydrochloride (PubChem CID 154809616) has the molecular formula C5H7Cl4NS
and a molecular weight of 255.00 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)methanamine;dihydrochloride.
Molecular Properties
| Compound Name | (2,5-dichlorothiophen-3-yl)methanamine;dihydrochloride |
| PubChem CID | 154809616 |
| Molecular Formula | C5H7Cl4NS |
| Molecular Weight | 255.00 g/mol |
| Exact Mass | 252.91 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)methanamine;dihydrochloride |
| SMILES | Cl.Cl.NCc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C5H5Cl2NS.2ClH/c6-4-1-3(2-8)5(7)9-4;;/h1H,2,8H2;2*1H |
| InChIKey | RWSIDRIPTACRCN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.00 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,5-dichlorothiophen-3-yl)methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dichlorothiophen-3-yl)methanamine;dihydrochloride?
The IUPAC name of (2,5-dichlorothiophen-3-yl)methanamine;dihydrochloride (CID 154809616) is (2,5-dichlorothiophen-3-yl)methanamine;dihydrochloride.
What is the SMILES notation for (2,5-dichlorothiophen-3-yl)methanamine;dihydrochloride?
The canonical SMILES for (2,5-dichlorothiophen-3-yl)methanamine;dihydrochloride is Cl.Cl.NCc1cc(Cl)sc1Cl.
What is the InChIKey of (2,5-dichlorothiophen-3-yl)methanamine;dihydrochloride?
The InChIKey is RWSIDRIPTACRCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5Cl2NS.2ClH/c6-4-1-3(2-8)5(7)9-4;;/h1H,2,8H2;2*1H.
What are the key properties of (2,5-dichlorothiophen-3-yl)methanamine;dihydrochloride?
(2,5-dichlorothiophen-3-yl)methanamine;dihydrochloride has a molecular weight of 255.00 g/mol, XLogP of 3.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dichlorothiophen-3-yl)methanamine;dihydrochloride is sourced from PubChem (CID 154809616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).