C14H7N3O — CID 15480973
6,10,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-8-one (PubChem CID 15480973) has the molecular formula C14H7N3O and a molecular weight of 233.23 g/mol. Its IUPAC name is 6,10,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-8-one.
| Compound Name | 6,10,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-8-one |
|---|---|
| PubChem CID | 15480973 |
| Molecular Formula | C14H7N3O |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 6,10,16-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-8-one |
| SMILES | O=C1c2ncccc2-c2nccc3ccnc1c23 |
| InChI | InChI=1S/C14H7N3O/c18-14-12-9(2-1-5-15-12)11-10-8(3-6-16-11)4-7-17-13(10)14/h1-7H |
| InChIKey | OPUPHQHVRPYOTC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |