C13H16BF2NO3 — CID 154809973
(4-cyano-3,5-difluorophenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 154809973) has the molecular formula C13H16BF2NO3 and a molecular weight of 283.08 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | (4-cyano-3,5-difluorophenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 154809973 |
| Molecular Formula | C13H16BF2NO3 |
| Molecular Weight | 283.08 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1cc(F)c(C#N)c(F)c1 |
| InChI | InChI=1S/C13H16BF2NO3/c1-12(2,18)13(3,4)20-14(19)8-5-10(15)9(7-17)11(16)6-8/h5-6,18-19H,1-4H3 |
| InChIKey | FJBCUXBMIDTGFO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.08 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|