C14H20N2 — CID 15481011
1-(1,2,3,4-tetrahydronaphthalen-1-yl)piperazine (PubChem CID 15481011) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydronaphthalen-1-yl)piperazine.
| Compound Name | 1-(1,2,3,4-tetrahydronaphthalen-1-yl)piperazine |
|---|---|
| PubChem CID | 15481011 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-(1,2,3,4-tetrahydronaphthalen-1-yl)piperazine |
| SMILES | c1ccc2c(c1)CCCC2N1CCNCC1 |
| InChI | InChI=1S/C14H20N2/c1-2-6-13-12(4-1)5-3-7-14(13)16-10-8-15-9-11-16/h1-2,4,6,14-15H,3,5,7-11H2 |
| InChIKey | DLLBLNFCUXJHHV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |