C12H10ClN3O3 — CID 154810801
3-[(5-chloro-1,3-benzoxazol-2-yl)amino]piperidine-2,6-dione (PubChem CID 154810801) has the molecular formula C12H10ClN3O3 and a molecular weight of 279.68 g/mol. Its IUPAC name is 3-[(5-chloro-1,3-benzoxazol-2-yl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(5-chloro-1,3-benzoxazol-2-yl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154810801 |
| Molecular Formula | C12H10ClN3O3 |
| Molecular Weight | 279.68 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 3-[(5-chloro-1,3-benzoxazol-2-yl)amino]piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2nc3cc(Cl)ccc3o2)C(=O)N1 |
| InChI | InChI=1S/C12H10ClN3O3/c13-6-1-3-9-8(5-6)15-12(19-9)14-7-2-4-10(17)16-11(7)18/h1,3,5,7H,2,4H2,(H,14,15)(H,16,17,18) |
| InChIKey | YJZYWQLSWYSSNB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.68 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|