C21H29N3O2 — CID 154811367
[(3aS,7aR)-2-[[1-(4-propan-2-ylphenyl)pyrazol-4-yl]methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 154811367) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is [(3aS,7aR)-2-[[1-(4-propan-2-ylphenyl)pyrazol-4-yl]methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [(3aS,7aR)-2-[[1-(4-propan-2-ylphenyl)pyrazol-4-yl]methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 154811367 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | [(3aS,7aR)-2-[[1-(4-propan-2-ylphenyl)pyrazol-4-yl]methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | CC(C)c1ccc(-n2cc(CN3C[C@@H]4CCOC[C@]4(CO)C3)cn2)cc1 |
| InChI | InChI=1S/C21H29N3O2/c1-16(2)18-3-5-20(6-4-18)24-11-17(9-22-24)10-23-12-19-7-8-26-15-21(19,13-23)14-25/h3-6,9,11,16,19,25H,7-8,10,12-15H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | WICKGDCBQOQPOA-PZJWPPBQSA-N |
| XLogP | 2.83 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |