C18H23N3O2 — CID 154811384
[(3aS,7aR)-2-[(4-pyrazol-1-ylphenyl)methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 154811384) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is [(3aS,7aR)-2-[(4-pyrazol-1-ylphenyl)methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [(3aS,7aR)-2-[(4-pyrazol-1-ylphenyl)methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 154811384 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | [(3aS,7aR)-2-[(4-pyrazol-1-ylphenyl)methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | OC[C@]12COCC[C@H]1CN(Cc1ccc(-n3cccn3)cc1)C2 |
| InChI | InChI=1S/C18H23N3O2/c22-13-18-12-20(11-16(18)6-9-23-14-18)10-15-2-4-17(5-3-15)21-8-1-7-19-21/h1-5,7-8,16,22H,6,9-14H2/t16-,18+/m0/s1 |
| InChIKey | ZGHOHSRUIPRFPR-FUHWJXTLSA-N |
| XLogP | 1.70 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |