C17H32N2O2 — CID 154811608
[(3aS,7aR)-2-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 154811608) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is [(3aS,7aR)-2-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [(3aS,7aR)-2-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 154811608 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | [(3aS,7aR)-2-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | CC1(C)CC(N2C[C@@H]3CCOC[C@]3(CO)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C17H32N2O2/c1-15(2)7-14(8-16(3,4)18-15)19-9-13-5-6-21-12-17(13,10-19)11-20/h13-14,18,20H,5-12H2,1-4H3/t13-,17+/m0/s1 |
| InChIKey | STRXZTDSNKYOSL-SUMWQHHRSA-N |
| XLogP | 1.63 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |