C19H27ClN2O2 — CID 154811741
[(3aS,7aR)-2-[1-(2-chlorophenyl)piperidin-4-yl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 154811741) has the molecular formula C19H27ClN2O2 and a molecular weight of 350.89 g/mol. Its IUPAC name is [(3aS,7aR)-2-[1-(2-chlorophenyl)piperidin-4-yl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [(3aS,7aR)-2-[1-(2-chlorophenyl)piperidin-4-yl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 154811741 |
| Molecular Formula | C19H27ClN2O2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | [(3aS,7aR)-2-[1-(2-chlorophenyl)piperidin-4-yl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | OC[C@]12COCC[C@H]1CN(C1CCN(c3ccccc3Cl)CC1)C2 |
| InChI | InChI=1S/C19H27ClN2O2/c20-17-3-1-2-4-18(17)21-8-5-16(6-9-21)22-11-15-7-10-24-14-19(15,12-22)13-23/h1-4,15-16,23H,5-14H2/t15-,19+/m0/s1 |
| InChIKey | NKYNJGNKWPDXQG-HNAYVOBHSA-N |
| XLogP | 2.64 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |