C20H29NO3 — CID 154811956
[(3aS,7aR)-2-[(6-ethoxy-2,3-dihydro-1H-inden-5-yl)methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 154811956) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is [(3aS,7aR)-2-[(6-ethoxy-2,3-dihydro-1H-inden-5-yl)methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [(3aS,7aR)-2-[(6-ethoxy-2,3-dihydro-1H-inden-5-yl)methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 154811956 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | [(3aS,7aR)-2-[(6-ethoxy-2,3-dihydro-1H-inden-5-yl)methyl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | CCOc1cc2c(cc1CN1C[C@@H]3CCOC[C@]3(CO)C1)CCC2 |
| InChI | InChI=1S/C20H29NO3/c1-2-24-19-9-16-5-3-4-15(16)8-17(19)10-21-11-18-6-7-23-14-20(18,12-21)13-22/h8-9,18,22H,2-7,10-14H2,1H3/t18-,20+/m0/s1 |
| InChIKey | DPMSGRAQASDCKM-AZUAARDMSA-N |
| XLogP | 2.40 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |