C20H26O4 — CID 154812469
(2Z,6E,8Z)-6-methyl-8-(3-methyl-5-oxofuran-2-ylidene)-2-(4-methylpent-3-enyl)octa-2,6-dienoic acid (PubChem CID 154812469) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (2Z,6E,8Z)-6-methyl-8-(3-methyl-5-oxofuran-2-ylidene)-2-(4-methylpent-3-enyl)octa-2,6-dienoic acid.
| Compound Name | (2Z,6E,8Z)-6-methyl-8-(3-methyl-5-oxofuran-2-ylidene)-2-(4-methylpent-3-enyl)octa-2,6-dienoic acid |
|---|---|
| PubChem CID | 154812469 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (2Z,6E,8Z)-6-methyl-8-(3-methyl-5-oxofuran-2-ylidene)-2-(4-methylpent-3-enyl)octa-2,6-dienoic acid |
| SMILES | CC(C)=CCC/C(=C/CC/C(C)=C/C=C1\OC(=O)C=C1C)C(=O)O |
| InChI | InChI=1S/C20H26O4/c1-14(2)7-5-9-17(20(22)23)10-6-8-15(3)11-12-18-16(4)13-19(21)24-18/h7,10-13H,5-6,8-9H2,1-4H3,(H,22,23)/b15-11+,17-10-,18-12- |
| InChIKey | XMGYICKYGJRMIY-DTHZJZCXSA-N |
| XLogP | 4.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|