C21H36O8 — CID 154812495
5,5-dimethyl-4-[(E)-3-methyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoct-3-enyl]oxolan-2-one (PubChem CID 154812495) has the molecular formula C21H36O8 and a molecular weight of 416.51 g/mol. Its IUPAC name is 5,5-dimethyl-4-[(E)-3-methyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoct-3-enyl]oxolan-2-one.
| Compound Name | 5,5-dimethyl-4-[(E)-3-methyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoct-3-enyl]oxolan-2-one |
|---|---|
| PubChem CID | 154812495 |
| Molecular Formula | C21H36O8 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 5,5-dimethyl-4-[(E)-3-methyl-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoct-3-enyl]oxolan-2-one |
| SMILES | C/C(=C\CCC(C)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)CCC1CC(=O)OC1(C)C |
| InChI | InChI=1S/C21H36O8/c1-12(8-9-14-10-16(23)29-21(14,3)4)6-5-7-13(2)27-20-19(26)18(25)17(24)15(11-22)28-20/h6,13-15,17-20,22,24-26H,5,7-11H2,1-4H3/b12-6+/t13?,14?,15-,17-,18+,19-,20-/m1/s1 |
| InChIKey | ZADCROHMCBYQOL-OVVWQPKZSA-N |
| XLogP | 1.04 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|