C20H32O3 — CID 154812593
(E)-5-[(1R,3S,4aS,5S,8aS)-3-hydroxy-1,4a,5-trimethyl-2-methylidene-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-yl]-3-methylpent-2-enoic acid (PubChem CID 154812593) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (E)-5-[(1R,3S,4aS,5S,8aS)-3-hydroxy-1,4a,5-trimethyl-2-methylidene-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-yl]-3-methylpent-2-enoic acid.
| Compound Name | (E)-5-[(1R,3S,4aS,5S,8aS)-3-hydroxy-1,4a,5-trimethyl-2-methylidene-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-yl]-3-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 154812593 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (E)-5-[(1R,3S,4aS,5S,8aS)-3-hydroxy-1,4a,5-trimethyl-2-methylidene-4,5,6,7,8,8a-hexahydro-3H-naphthalen-1-yl]-3-methylpent-2-enoic acid |
| SMILES | C=C1[C@@H](O)C[C@@]2(C)[C@@H](C)CCC[C@@H]2[C@@]1(C)CC/C(C)=C/C(=O)O |
| InChI | InChI=1S/C20H32O3/c1-13(11-18(22)23)9-10-19(4)15(3)16(21)12-20(5)14(2)7-6-8-17(19)20/h11,14,16-17,21H,3,6-10,12H2,1-2,4-5H3,(H,22,23)/b13-11+/t14-,16-,17+,19-,20-/m0/s1 |
| InChIKey | RRGXTNAHUODMQF-QFFKMUHGSA-N |
| XLogP | 4.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|