C23H16O3S2 — CID 15481262
(4-naphtho[3,2-b][1]benzothiol-11-ylphenyl) methanesulfonate (PubChem CID 15481262) has the molecular formula C23H16O3S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (4-naphtho[3,2-b][1]benzothiol-11-ylphenyl) methanesulfonate.
| Compound Name | (4-naphtho[3,2-b][1]benzothiol-11-ylphenyl) methanesulfonate |
|---|---|
| PubChem CID | 15481262 |
| Molecular Formula | C23H16O3S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | (4-naphtho[3,2-b][1]benzothiol-11-ylphenyl) methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(-c2c3ccccc3cc3sc4ccccc4c23)cc1 |
| InChI | InChI=1S/C23H16O3S2/c1-28(24,25)26-17-12-10-15(11-13-17)22-18-7-3-2-6-16(18)14-21-23(22)19-8-4-5-9-20(19)27-21/h2-14H,1H3 |
| InChIKey | HMAREMXYRYGLPC-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|