C18H28N4O2 — CID 154812842
(3aS,5S,6S,7aR)-N-cyclopentyl-5-hydroxy-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide (PubChem CID 154812842) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is (3aS,5S,6S,7aR)-N-cyclopentyl-5-hydroxy-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide.
| Compound Name | (3aS,5S,6S,7aR)-N-cyclopentyl-5-hydroxy-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 154812842 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | (3aS,5S,6S,7aR)-N-cyclopentyl-5-hydroxy-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
| SMILES | Cc1cnn([C@H]2C[C@H]3CN(C(=O)NC4CCCC4)C[C@H]3C[C@@H]2O)c1 |
| InChI | InChI=1S/C18H28N4O2/c1-12-8-19-22(9-12)16-6-13-10-21(11-14(13)7-17(16)23)18(24)20-15-4-2-3-5-15/h8-9,13-17,23H,2-7,10-11H2,1H3,(H,20,24)/t13-,14+,16-,17-/m0/s1 |
| InChIKey | RHVKMYQWGWWEFI-FSDCSDTHSA-N |
| XLogP | 2.09 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |