C22H33F2N3O — CID 154812865
(3aS,5S,6S,7aR)-5-(cyclopropylmethoxy)-2-(4,4-difluorocyclohexyl)-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 154812865) has the molecular formula C22H33F2N3O and a molecular weight of 393.52 g/mol. Its IUPAC name is (3aS,5S,6S,7aR)-5-(cyclopropylmethoxy)-2-(4,4-difluorocyclohexyl)-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aS,5S,6S,7aR)-5-(cyclopropylmethoxy)-2-(4,4-difluorocyclohexyl)-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 154812865 |
| Molecular Formula | C22H33F2N3O |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | (3aS,5S,6S,7aR)-5-(cyclopropylmethoxy)-2-(4,4-difluorocyclohexyl)-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | Cc1cnn([C@H]2C[C@H]3CN(C4CCC(F)(F)CC4)C[C@H]3C[C@@H]2OCC2CC2)c1 |
| InChI | InChI=1S/C22H33F2N3O/c1-15-10-25-27(11-15)20-8-17-12-26(19-4-6-22(23,24)7-5-19)13-18(17)9-21(20)28-14-16-2-3-16/h10-11,16-21H,2-9,12-14H2,1H3/t17-,18+,20-,21-/m0/s1 |
| InChIKey | UPQVAUFLJNMPFY-YHELAOLJSA-N |
| XLogP | 4.45 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |