C19H29F2N3O — CID 154812872
(3aS,5S,6S,7aR)-2-(4,4-difluorocyclohexyl)-5-methoxy-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 154812872) has the molecular formula C19H29F2N3O and a molecular weight of 353.46 g/mol. Its IUPAC name is (3aS,5S,6S,7aR)-2-(4,4-difluorocyclohexyl)-5-methoxy-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aS,5S,6S,7aR)-2-(4,4-difluorocyclohexyl)-5-methoxy-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 154812872 |
| Molecular Formula | C19H29F2N3O |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | (3aS,5S,6S,7aR)-2-(4,4-difluorocyclohexyl)-5-methoxy-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CO[C@H]1C[C@@H]2CN(C3CCC(F)(F)CC3)C[C@@H]2C[C@@H]1n1cc(C)cn1 |
| InChI | InChI=1S/C19H29F2N3O/c1-13-9-22-24(10-13)17-7-14-11-23(12-15(14)8-18(17)25-2)16-3-5-19(20,21)6-4-16/h9-10,14-18H,3-8,11-12H2,1-2H3/t14-,15+,17-,18-/m0/s1 |
| InChIKey | NWCKYHIUZKCXEV-MVJTYMMSSA-N |
| XLogP | 3.67 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |