C18H25N5O — CID 154812943
(3aS,5S,6S,7aR)-5-methoxy-6-(4-methylpyrazol-1-yl)-2-(pyrimidin-5-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 154812943) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is (3aS,5S,6S,7aR)-5-methoxy-6-(4-methylpyrazol-1-yl)-2-(pyrimidin-5-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aS,5S,6S,7aR)-5-methoxy-6-(4-methylpyrazol-1-yl)-2-(pyrimidin-5-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 154812943 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | (3aS,5S,6S,7aR)-5-methoxy-6-(4-methylpyrazol-1-yl)-2-(pyrimidin-5-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CO[C@H]1C[C@@H]2CN(Cc3cncnc3)C[C@@H]2C[C@@H]1n1cc(C)cn1 |
| InChI | InChI=1S/C18H25N5O/c1-13-5-21-23(8-13)17-3-15-10-22(9-14-6-19-12-20-7-14)11-16(15)4-18(17)24-2/h5-8,12,15-18H,3-4,9-11H2,1-2H3/t15-,16+,17-,18-/m0/s1 |
| InChIKey | JNNPBDXUVPRJJF-MHORFTMASA-N |
| XLogP | 2.08 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |