C21H34N4O — CID 154813063
(3aS,5S,6S,7aR)-5-(cyclopropylmethoxy)-2-(1-methylpiperidin-4-yl)-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 154813063) has the molecular formula C21H34N4O and a molecular weight of 358.53 g/mol. Its IUPAC name is (3aS,5S,6S,7aR)-5-(cyclopropylmethoxy)-2-(1-methylpiperidin-4-yl)-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aS,5S,6S,7aR)-5-(cyclopropylmethoxy)-2-(1-methylpiperidin-4-yl)-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 154813063 |
| Molecular Formula | C21H34N4O |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | (3aS,5S,6S,7aR)-5-(cyclopropylmethoxy)-2-(1-methylpiperidin-4-yl)-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CN1CCC(N2C[C@H]3C[C@H](OCC4CC4)[C@@H](n4cccn4)C[C@H]3C2)CC1 |
| InChI | InChI=1S/C21H34N4O/c1-23-9-5-19(6-10-23)24-13-17-11-20(25-8-2-7-22-25)21(12-18(17)14-24)26-15-16-3-4-16/h2,7-8,16-21H,3-6,9-15H2,1H3/t17-,18+,20-,21-/m0/s1 |
| InChIKey | WXWKCRCUYSFSNO-YHELAOLJSA-N |
| XLogP | 2.66 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |