C17H25F2N3O — CID 154813080
(3aS,5S,6S,7aR)-2-(4,4-difluorocyclohexyl)-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 154813080) has the molecular formula C17H25F2N3O and a molecular weight of 325.40 g/mol. Its IUPAC name is (3aS,5S,6S,7aR)-2-(4,4-difluorocyclohexyl)-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aS,5S,6S,7aR)-2-(4,4-difluorocyclohexyl)-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 154813080 |
| Molecular Formula | C17H25F2N3O |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (3aS,5S,6S,7aR)-2-(4,4-difluorocyclohexyl)-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | O[C@H]1C[C@@H]2CN(C3CCC(F)(F)CC3)C[C@@H]2C[C@@H]1n1cccn1 |
| InChI | InChI=1S/C17H25F2N3O/c18-17(19)4-2-14(3-5-17)21-10-12-8-15(22-7-1-6-20-22)16(23)9-13(12)11-21/h1,6-7,12-16,23H,2-5,8-11H2/t12-,13+,15-,16-/m0/s1 |
| InChIKey | XVHZKLLMTUWGPX-XRGAULLZSA-N |
| XLogP | 2.70 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |