C21H33N3O — CID 154813122
(3aS,5S,6S,7aR)-2-(cyclopentylmethyl)-5-(cyclopropylmethoxy)-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 154813122) has the molecular formula C21H33N3O and a molecular weight of 343.52 g/mol. Its IUPAC name is (3aS,5S,6S,7aR)-2-(cyclopentylmethyl)-5-(cyclopropylmethoxy)-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aS,5S,6S,7aR)-2-(cyclopentylmethyl)-5-(cyclopropylmethoxy)-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 154813122 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | (3aS,5S,6S,7aR)-2-(cyclopentylmethyl)-5-(cyclopropylmethoxy)-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | c1cnn([C@H]2C[C@H]3CN(CC4CCCC4)C[C@H]3C[C@@H]2OCC2CC2)c1 |
| InChI | InChI=1S/C21H33N3O/c1-2-5-16(4-1)12-23-13-18-10-20(24-9-3-8-22-24)21(11-19(18)14-23)25-15-17-6-7-17/h3,8-9,16-21H,1-2,4-7,10-15H2/t18-,19+,20-,21-/m0/s1 |
| InChIKey | WSBDFMSXWJZQTN-WOZUAGRISA-N |
| XLogP | 3.75 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |