C17H25N5O — CID 154813147
(3aS,5S,6S,7aR)-5-methoxy-2-[(2-methylpyrazol-3-yl)methyl]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 154813147) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is (3aS,5S,6S,7aR)-5-methoxy-2-[(2-methylpyrazol-3-yl)methyl]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aS,5S,6S,7aR)-5-methoxy-2-[(2-methylpyrazol-3-yl)methyl]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 154813147 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | (3aS,5S,6S,7aR)-5-methoxy-2-[(2-methylpyrazol-3-yl)methyl]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CO[C@H]1C[C@@H]2CN(Cc3ccnn3C)C[C@@H]2C[C@@H]1n1cccn1 |
| InChI | InChI=1S/C17H25N5O/c1-20-15(4-6-18-20)12-21-10-13-8-16(22-7-3-5-19-22)17(23-2)9-14(13)11-21/h3-7,13-14,16-17H,8-12H2,1-2H3/t13-,14+,16-,17-/m0/s1 |
| InChIKey | CMLLLZGTFYTTCU-FSDCSDTHSA-N |
| XLogP | 1.71 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |