About 3,4-dihydroxy-3,5-dimethyl-6-[(E)-4-methylhex-4-en-2-yl]oxan-2-one
3,4-dihydroxy-3,5-dimethyl-6-[(E)-4-methylhex-4-en-2-yl]oxan-2-one (PubChem CID 154814085) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is 3,4-dihydroxy-3,5-dimethyl-6-[(E)-4-methylhex-4-en-2-yl]oxan-2-one.
Molecular Properties
| Compound Name | 3,4-dihydroxy-3,5-dimethyl-6-[(E)-4-methylhex-4-en-2-yl]oxan-2-one |
| PubChem CID | 154814085 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 3,4-dihydroxy-3,5-dimethyl-6-[(E)-4-methylhex-4-en-2-yl]oxan-2-one |
| SMILES | C/C=C(\C)CC(C)C1OC(=O)C(C)(O)C(O)C1C |
| InChI | InChI=1S/C14H24O4/c1-6-8(2)7-9(3)11-10(4)12(15)14(5,17)13(16)18-11/h6,9-12,15,17H,7H2,1-5H3/b8-6+ |
| InChIKey | UKWNFIJQRGRIDQ-SOFGYWHQSA-N |
| XLogP | 1.65 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydroxy-3,5-dimethyl-6-[(E)-4-methylhex-4-en-2-yl]oxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydroxy-3,5-dimethyl-6-[(E)-4-methylhex-4-en-2-yl]oxan-2-one?
The IUPAC name of 3,4-dihydroxy-3,5-dimethyl-6-[(E)-4-methylhex-4-en-2-yl]oxan-2-one (CID 154814085) is 3,4-dihydroxy-3,5-dimethyl-6-[(E)-4-methylhex-4-en-2-yl]oxan-2-one.
What is the SMILES notation for 3,4-dihydroxy-3,5-dimethyl-6-[(E)-4-methylhex-4-en-2-yl]oxan-2-one?
The canonical SMILES for 3,4-dihydroxy-3,5-dimethyl-6-[(E)-4-methylhex-4-en-2-yl]oxan-2-one is C/C=C(\C)CC(C)C1OC(=O)C(C)(O)C(O)C1C.
What is the InChIKey of 3,4-dihydroxy-3,5-dimethyl-6-[(E)-4-methylhex-4-en-2-yl]oxan-2-one?
The InChIKey is UKWNFIJQRGRIDQ-SOFGYWHQSA-N. The full InChI is InChI=1S/C14H24O4/c1-6-8(2)7-9(3)11-10(4)12(15)14(5,17)13(16)18-11/h6,9-12,15,17H,7H2,1-5H3/b8-6+.
What are the key properties of 3,4-dihydroxy-3,5-dimethyl-6-[(E)-4-methylhex-4-en-2-yl]oxan-2-one?
3,4-dihydroxy-3,5-dimethyl-6-[(E)-4-methylhex-4-en-2-yl]oxan-2-one has a molecular weight of 256.34 g/mol, XLogP of 1.65, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxy-3,5-dimethyl-6-[(E)-4-methylhex-4-en-2-yl]oxan-2-one is sourced from PubChem (CID 154814085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).