About 3-bromo-6-fluoro-2,4-dimethylbenzenesulfonyl chloride
3-bromo-6-fluoro-2,4-dimethylbenzenesulfonyl chloride (PubChem CID 154814252) has the molecular formula C8H7BrClFO2S
and a molecular weight of 301.56 g/mol. Its IUPAC name is 3-bromo-6-fluoro-2,4-dimethylbenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 3-bromo-6-fluoro-2,4-dimethylbenzenesulfonyl chloride |
| PubChem CID | 154814252 |
| Molecular Formula | C8H7BrClFO2S |
| Molecular Weight | 301.56 g/mol |
| Exact Mass | 299.90 |
| IUPAC Name | 3-bromo-6-fluoro-2,4-dimethylbenzenesulfonyl chloride |
| SMILES | Cc1cc(F)c(S(=O)(=O)Cl)c(C)c1Br |
| InChI | InChI=1S/C8H7BrClFO2S/c1-4-3-6(11)8(14(10,12)13)5(2)7(4)9/h3H,1-2H3 |
| InChIKey | JRECROJKJLBYAN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-6-fluoro-2,4-dimethylbenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6-fluoro-2,4-dimethylbenzenesulfonyl chloride?
The IUPAC name of 3-bromo-6-fluoro-2,4-dimethylbenzenesulfonyl chloride (CID 154814252) is 3-bromo-6-fluoro-2,4-dimethylbenzenesulfonyl chloride.
What is the SMILES notation for 3-bromo-6-fluoro-2,4-dimethylbenzenesulfonyl chloride?
The canonical SMILES for 3-bromo-6-fluoro-2,4-dimethylbenzenesulfonyl chloride is Cc1cc(F)c(S(=O)(=O)Cl)c(C)c1Br.
What is the InChIKey of 3-bromo-6-fluoro-2,4-dimethylbenzenesulfonyl chloride?
The InChIKey is JRECROJKJLBYAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrClFO2S/c1-4-3-6(11)8(14(10,12)13)5(2)7(4)9/h3H,1-2H3.
What are the key properties of 3-bromo-6-fluoro-2,4-dimethylbenzenesulfonyl chloride?
3-bromo-6-fluoro-2,4-dimethylbenzenesulfonyl chloride has a molecular weight of 301.56 g/mol, XLogP of 3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6-fluoro-2,4-dimethylbenzenesulfonyl chloride is sourced from PubChem (CID 154814252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).