C9H12O — CID 154814300
(1R,2R,5S,6S)-tricyclo[4.2.1.02,5]non-7-en-3-ol (PubChem CID 154814300) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is (1R,2R,5S,6S)-tricyclo[4.2.1.02,5]non-7-en-3-ol.
| Compound Name | (1R,2R,5S,6S)-tricyclo[4.2.1.02,5]non-7-en-3-ol |
|---|---|
| PubChem CID | 154814300 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | (1R,2R,5S,6S)-tricyclo[4.2.1.02,5]non-7-en-3-ol |
| SMILES | OC1C[C@@H]2[C@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C9H12O/c10-8-4-7-5-1-2-6(3-5)9(7)8/h1-2,5-10H,3-4H2/t5-,6+,7+,8?,9-/m1/s1 |
| InChIKey | YFMCPIYUZPMGNA-SVBMCEDBSA-N |
| XLogP | 1.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|