About 5-(methoxymethyl)-5-methyl-1,2-dihydropyrrole;hydrochloride
5-(methoxymethyl)-5-methyl-1,2-dihydropyrrole;hydrochloride (PubChem CID 154814385) has the molecular formula C7H14ClNO
and a molecular weight of 163.65 g/mol. Its IUPAC name is 5-(methoxymethyl)-5-methyl-1,2-dihydropyrrole;hydrochloride.
Molecular Properties
| Compound Name | 5-(methoxymethyl)-5-methyl-1,2-dihydropyrrole;hydrochloride |
| PubChem CID | 154814385 |
| Molecular Formula | C7H14ClNO |
| Molecular Weight | 163.65 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 5-(methoxymethyl)-5-methyl-1,2-dihydropyrrole;hydrochloride |
| SMILES | COCC1(C)C=CCN1.Cl |
| InChI | InChI=1S/C7H13NO.ClH/c1-7(6-9-2)4-3-5-8-7;/h3-4,8H,5-6H2,1-2H3;1H |
| InChIKey | JEWSGDOOXMYEOP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.65 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(methoxymethyl)-5-methyl-1,2-dihydropyrrole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethyl)-5-methyl-1,2-dihydropyrrole;hydrochloride?
The IUPAC name of 5-(methoxymethyl)-5-methyl-1,2-dihydropyrrole;hydrochloride (CID 154814385) is 5-(methoxymethyl)-5-methyl-1,2-dihydropyrrole;hydrochloride.
What is the SMILES notation for 5-(methoxymethyl)-5-methyl-1,2-dihydropyrrole;hydrochloride?
The canonical SMILES for 5-(methoxymethyl)-5-methyl-1,2-dihydropyrrole;hydrochloride is COCC1(C)C=CCN1.Cl.
What is the InChIKey of 5-(methoxymethyl)-5-methyl-1,2-dihydropyrrole;hydrochloride?
The InChIKey is JEWSGDOOXMYEOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.ClH/c1-7(6-9-2)4-3-5-8-7;/h3-4,8H,5-6H2,1-2H3;1H.
What are the key properties of 5-(methoxymethyl)-5-methyl-1,2-dihydropyrrole;hydrochloride?
5-(methoxymethyl)-5-methyl-1,2-dihydropyrrole;hydrochloride has a molecular weight of 163.65 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)-5-methyl-1,2-dihydropyrrole;hydrochloride is sourced from PubChem (CID 154814385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).