C19H27N5O4 — CID 154815776
(2S)-6-amino-2-[[1-(5-methyl-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidine-4-carbonyl]amino]hexanoic acid (PubChem CID 154815776) has the molecular formula C19H27N5O4 and a molecular weight of 389.46 g/mol. Its IUPAC name is (2S)-6-amino-2-[[1-(5-methyl-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidine-4-carbonyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[1-(5-methyl-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidine-4-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 154815776 |
| Molecular Formula | C19H27N5O4 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | (2S)-6-amino-2-[[1-(5-methyl-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperidine-4-carbonyl]amino]hexanoic acid |
| SMILES | Cc1ccc2oc(N3CCC(C(=O)N[C@@H](CCCCN)C(=O)O)CC3)nc2n1 |
| InChI | InChI=1S/C19H27N5O4/c1-12-5-6-15-16(21-12)23-19(28-15)24-10-7-13(8-11-24)17(25)22-14(18(26)27)4-2-3-9-20/h5-6,13-14H,2-4,7-11,20H2,1H3,(H,22,25)(H,26,27)/t14-/m0/s1 |
| InChIKey | XLJPBJGVXSXPIE-AWEZNQCLSA-N |
| XLogP | 1.45 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|