C25H34N4O7 — CID 15481614
[1-[(5S)-5-acetyloxyhexyl]-3-(furan-2-ylmethyl)-8-methyl-2,6-dioxopurin-7-yl]methyl 2,2-dimethylpropanoate (PubChem CID 15481614) has the molecular formula C25H34N4O7 and a molecular weight of 502.57 g/mol. Its IUPAC name is [1-[(5S)-5-acetyloxyhexyl]-3-(furan-2-ylmethyl)-8-methyl-2,6-dioxopurin-7-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [1-[(5S)-5-acetyloxyhexyl]-3-(furan-2-ylmethyl)-8-methyl-2,6-dioxopurin-7-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 15481614 |
| Molecular Formula | C25H34N4O7 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | [1-[(5S)-5-acetyloxyhexyl]-3-(furan-2-ylmethyl)-8-methyl-2,6-dioxopurin-7-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(=O)O[C@@H](C)CCCCn1c(=O)c2c(nc(C)n2COC(=O)C(C)(C)C)n(Cc2ccco2)c1=O |
| InChI | InChI=1S/C25H34N4O7/c1-16(36-18(3)30)10-7-8-12-27-22(31)20-21(28(24(27)33)14-19-11-9-13-34-19)26-17(2)29(20)15-35-23(32)25(4,5)6/h9,11,13,16H,7-8,10,12,14-15H2,1-6H3/t16-/m0/s1 |
| InChIKey | WGFQXXBWYFPMAU-INIZCTEOSA-N |
| XLogP | 2.98 |
| TPSA | 127.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|