C19H34N2O3 — CID 154816225
2-ethyl-N-[[(1S,5S,6R,7R)-3-(3-methoxypropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide (PubChem CID 154816225) has the molecular formula C19H34N2O3 and a molecular weight of 338.49 g/mol. Its IUPAC name is 2-ethyl-N-[[(1S,5S,6R,7R)-3-(3-methoxypropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide.
| Compound Name | 2-ethyl-N-[[(1S,5S,6R,7R)-3-(3-methoxypropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide |
|---|---|
| PubChem CID | 154816225 |
| Molecular Formula | C19H34N2O3 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 2-ethyl-N-[[(1S,5S,6R,7R)-3-(3-methoxypropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide |
| SMILES | CCC(CC)C(=O)NC[C@H]1[C@H]2CN(CCCOC)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C19H34N2O3/c1-4-14(5-2)18(22)20-11-15-16-12-21(9-6-10-23-3)13-19(16)8-7-17(15)24-19/h14-17H,4-13H2,1-3H3,(H,20,22)/t15-,16+,17+,19+/m0/s1 |
| InChIKey | GQRSDEQEVJWQEP-DODZYUBVSA-N |
| XLogP | 2.05 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|