C18H19F3N2O3 — CID 154816289
(1S,3S,8R)-3-phenyl-9-(4,4,4-trifluorobutanoyl)-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one (PubChem CID 154816289) has the molecular formula C18H19F3N2O3 and a molecular weight of 368.36 g/mol. Its IUPAC name is (1S,3S,8R)-3-phenyl-9-(4,4,4-trifluorobutanoyl)-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one.
| Compound Name | (1S,3S,8R)-3-phenyl-9-(4,4,4-trifluorobutanoyl)-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one |
|---|---|
| PubChem CID | 154816289 |
| Molecular Formula | C18H19F3N2O3 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (1S,3S,8R)-3-phenyl-9-(4,4,4-trifluorobutanoyl)-2-oxa-5,9-diazatricyclo[6.3.0.01,5]undecan-6-one |
| SMILES | O=C(CCC(F)(F)F)N1CC[C@@]23O[C@@H](c4ccccc4)CN2C(=O)C[C@@H]13 |
| InChI | InChI=1S/C18H19F3N2O3/c19-18(20,21)7-6-15(24)22-9-8-17-14(22)10-16(25)23(17)11-13(26-17)12-4-2-1-3-5-12/h1-5,13-14H,6-11H2/t13-,14-,17+/m1/s1 |
| InChIKey | DUYPGIWXOVPVLU-CPUCHLNUSA-N |
| XLogP | 2.63 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |