C23H26N2O4 — CID 154816342
N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(1,3-benzodioxol-5-yl)propanamide (PubChem CID 154816342) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(1,3-benzodioxol-5-yl)propanamide.
| Compound Name | N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(1,3-benzodioxol-5-yl)propanamide |
|---|---|
| PubChem CID | 154816342 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-[(3S,7R,8aS)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-3-(1,3-benzodioxol-5-yl)propanamide |
| SMILES | O=C(CCc1ccc2c(c1)OCO2)N[C@@H]1C[C@H]2CO[C@@H](c3ccccc3)CN2C1 |
| InChI | InChI=1S/C23H26N2O4/c26-23(9-7-16-6-8-20-21(10-16)29-15-28-20)24-18-11-19-14-27-22(13-25(19)12-18)17-4-2-1-3-5-17/h1-6,8,10,18-19,22H,7,9,11-15H2,(H,24,26)/t18-,19+,22-/m1/s1 |
| InChIKey | AINCYBNGOVPHOT-XQBPLPMBSA-N |
| XLogP | 2.68 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |