C22H24F2N2O3 — CID 154816529
(5aS,8aS)-5-benzyl-7-[(2,3-difluoro-6-methoxyphenyl)methyl]-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one (PubChem CID 154816529) has the molecular formula C22H24F2N2O3 and a molecular weight of 402.44 g/mol. Its IUPAC name is (5aS,8aS)-5-benzyl-7-[(2,3-difluoro-6-methoxyphenyl)methyl]-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one.
| Compound Name | (5aS,8aS)-5-benzyl-7-[(2,3-difluoro-6-methoxyphenyl)methyl]-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one |
|---|---|
| PubChem CID | 154816529 |
| Molecular Formula | C22H24F2N2O3 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (5aS,8aS)-5-benzyl-7-[(2,3-difluoro-6-methoxyphenyl)methyl]-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one |
| SMILES | COc1ccc(F)c(F)c1CN1C[C@@H]2OCCC(=O)N(Cc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C22H24F2N2O3/c1-28-19-8-7-17(23)22(24)16(19)12-25-13-18-20(14-25)29-10-9-21(27)26(18)11-15-5-3-2-4-6-15/h2-8,18,20H,9-14H2,1H3/t18-,20-/m0/s1 |
| InChIKey | DZIBZSPYDUAJOF-ICSRJNTNSA-N |
| XLogP | 2.98 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |