C20H24N4O — CID 154816686
[4-[[2-(3-pyrazol-1-ylphenyl)imidazol-1-yl]methyl]cyclohexyl]methanol (PubChem CID 154816686) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is [4-[[2-(3-pyrazol-1-ylphenyl)imidazol-1-yl]methyl]cyclohexyl]methanol.
| Compound Name | [4-[[2-(3-pyrazol-1-ylphenyl)imidazol-1-yl]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 154816686 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | [4-[[2-(3-pyrazol-1-ylphenyl)imidazol-1-yl]methyl]cyclohexyl]methanol |
| SMILES | OCC1CCC(Cn2ccnc2-c2cccc(-n3cccn3)c2)CC1 |
| InChI | InChI=1S/C20H24N4O/c25-15-17-7-5-16(6-8-17)14-23-12-10-21-20(23)18-3-1-4-19(13-18)24-11-2-9-22-24/h1-4,9-13,16-17,25H,5-8,14-15H2 |
| InChIKey | LJPVZJAGJICJCJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |