C23H30N2O4 — CID 154816885
N-[(3S,7R,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-methyl-2-naphthalen-1-yloxypropanamide (PubChem CID 154816885) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-methyl-2-naphthalen-1-yloxypropanamide.
| Compound Name | N-[(3S,7R,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-methyl-2-naphthalen-1-yloxypropanamide |
|---|---|
| PubChem CID | 154816885 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | N-[(3S,7R,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-methyl-2-naphthalen-1-yloxypropanamide |
| SMILES | CC(C)(Oc1cccc2ccccc12)C(=O)N[C@@H]1C[C@H]2CO[C@@H](CCO)CN2C1 |
| InChI | InChI=1S/C23H30N2O4/c1-23(2,29-21-9-5-7-16-6-3-4-8-20(16)21)22(27)24-17-12-18-15-28-19(10-11-26)14-25(18)13-17/h3-9,17-19,26H,10-15H2,1-2H3,(H,24,27)/t17-,18+,19+/m1/s1 |
| InChIKey | MDCRHMSYWNPZLB-QYZOEREBSA-N |
| XLogP | 2.34 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |