C29H45N3O4S — CID 154817067
(1R,2S,8S,11R,16R)-18-(3,4-dimethylphenyl)sulfonyl-11-methyl-8-propan-2-yl-7,14,18-triazatricyclo[14.3.1.02,14]icosane-6,13-dione (PubChem CID 154817067) has the molecular formula C29H45N3O4S and a molecular weight of 531.76 g/mol. Its IUPAC name is (1R,2S,8S,11R,16R)-18-(3,4-dimethylphenyl)sulfonyl-11-methyl-8-propan-2-yl-7,14,18-triazatricyclo[14.3.1.02,14]icosane-6,13-dione.
| Compound Name | (1R,2S,8S,11R,16R)-18-(3,4-dimethylphenyl)sulfonyl-11-methyl-8-propan-2-yl-7,14,18-triazatricyclo[14.3.1.02,14]icosane-6,13-dione |
|---|---|
| PubChem CID | 154817067 |
| Molecular Formula | C29H45N3O4S |
| Molecular Weight | 531.76 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | (1R,2S,8S,11R,16R)-18-(3,4-dimethylphenyl)sulfonyl-11-methyl-8-propan-2-yl-7,14,18-triazatricyclo[14.3.1.02,14]icosane-6,13-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3C[C@H](C2)[C@@H]2CCCC(=O)N[C@H](C(C)C)CC[C@@H](C)CC(=O)N2C3)cc1C |
| InChI | InChI=1S/C29H45N3O4S/c1-19(2)26-12-9-20(3)13-29(34)32-17-23-15-24(27(32)7-6-8-28(33)30-26)18-31(16-23)37(35,36)25-11-10-21(4)22(5)14-25/h10-11,14,19-20,23-24,26-27H,6-9,12-13,15-18H2,1-5H3,(H,30,33)/t20-,23+,24-,26+,27+/m1/s1 |
| InChIKey | NVSMPLPGRDDOTI-DQAVEMKTSA-N |
| XLogP | 4.27 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.76 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |