About [1-(4,5-dimethylpyridazin-3-yl)pyrrolidin-3-yl]methanesulfonamide
[1-(4,5-dimethylpyridazin-3-yl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 154817601) has the molecular formula C11H18N4O2S
and a molecular weight of 270.36 g/mol. Its IUPAC name is [1-(4,5-dimethylpyridazin-3-yl)pyrrolidin-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | [1-(4,5-dimethylpyridazin-3-yl)pyrrolidin-3-yl]methanesulfonamide |
| PubChem CID | 154817601 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | [1-(4,5-dimethylpyridazin-3-yl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | Cc1cnnc(N2CCC(CS(N)(=O)=O)C2)c1C |
| InChI | InChI=1S/C11H18N4O2S/c1-8-5-13-14-11(9(8)2)15-4-3-10(6-15)7-18(12,16)17/h5,10H,3-4,6-7H2,1-2H3,(H2,12,16,17) |
| InChIKey | WSACHAYXSHSWGA-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(4,5-dimethylpyridazin-3-yl)pyrrolidin-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4,5-dimethylpyridazin-3-yl)pyrrolidin-3-yl]methanesulfonamide?
The IUPAC name of [1-(4,5-dimethylpyridazin-3-yl)pyrrolidin-3-yl]methanesulfonamide (CID 154817601) is [1-(4,5-dimethylpyridazin-3-yl)pyrrolidin-3-yl]methanesulfonamide.
What is the SMILES notation for [1-(4,5-dimethylpyridazin-3-yl)pyrrolidin-3-yl]methanesulfonamide?
The canonical SMILES for [1-(4,5-dimethylpyridazin-3-yl)pyrrolidin-3-yl]methanesulfonamide is Cc1cnnc(N2CCC(CS(N)(=O)=O)C2)c1C.
What is the InChIKey of [1-(4,5-dimethylpyridazin-3-yl)pyrrolidin-3-yl]methanesulfonamide?
The InChIKey is WSACHAYXSHSWGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O2S/c1-8-5-13-14-11(9(8)2)15-4-3-10(6-15)7-18(12,16)17/h5,10H,3-4,6-7H2,1-2H3,(H2,12,16,17).
What are the key properties of [1-(4,5-dimethylpyridazin-3-yl)pyrrolidin-3-yl]methanesulfonamide?
[1-(4,5-dimethylpyridazin-3-yl)pyrrolidin-3-yl]methanesulfonamide has a molecular weight of 270.36 g/mol, XLogP of 0.21, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4,5-dimethylpyridazin-3-yl)pyrrolidin-3-yl]methanesulfonamide is sourced from PubChem (CID 154817601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).