C34H47F5O5S — CID 15481761
7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromene (PubChem CID 15481761) has the molecular formula C34H47F5O5S and a molecular weight of 662.80 g/mol. Its IUPAC name is 7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromene.
| Compound Name | 7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromene |
|---|---|
| PubChem CID | 15481761 |
| Molecular Formula | C34H47F5O5S |
| Molecular Weight | 662.80 g/mol |
| Exact Mass | 662.31 |
| IUPAC Name | 7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromene |
| SMILES | COCOc1ccc(C2(C)COc3cc(OCOC)ccc3C2CCCCCCCCCSCCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C34H47F5O5S/c1-32(26-13-15-27(16-14-26)43-24-40-2)23-42-31-22-28(44-25-41-3)17-18-29(31)30(32)12-9-7-5-4-6-8-10-20-45-21-11-19-33(35,36)34(37,38)39/h13-18,22,30H,4-12,19-21,23-25H2,1-3H3 |
| InChIKey | NRKOXBFWUHLVBT-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.80 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|