C30H39F5O3S — CID 15481762
3-(4-hydroxyphenyl)-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromen-7-ol (PubChem CID 15481762) has the molecular formula C30H39F5O3S and a molecular weight of 574.70 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromen-7-ol.
| Compound Name | 3-(4-hydroxyphenyl)-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromen-7-ol |
|---|---|
| PubChem CID | 15481762 |
| Molecular Formula | C30H39F5O3S |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 3-(4-hydroxyphenyl)-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromen-7-ol |
| SMILES | CC1(c2ccc(O)cc2)COc2cc(O)ccc2C1CCCCCCCCCSCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C30H39F5O3S/c1-28(22-11-13-23(36)14-12-22)21-38-27-20-24(37)15-16-25(27)26(28)10-7-5-3-2-4-6-8-18-39-19-9-17-29(31,32)30(33,34)35/h11-16,20,26,36-37H,2-10,17-19,21H2,1H3 |
| InChIKey | QEVKLFFCUJYDEM-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.70 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|