C20H27F3N2O — CID 154817628
N,N-dimethyl-1-[(1S,5S,6R,7R)-3-[[3-(2,2,2-trifluoroethyl)phenyl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanamine (PubChem CID 154817628) has the molecular formula C20H27F3N2O and a molecular weight of 368.44 g/mol. Its IUPAC name is N,N-dimethyl-1-[(1S,5S,6R,7R)-3-[[3-(2,2,2-trifluoroethyl)phenyl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[(1S,5S,6R,7R)-3-[[3-(2,2,2-trifluoroethyl)phenyl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanamine |
|---|---|
| PubChem CID | 154817628 |
| Molecular Formula | C20H27F3N2O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | N,N-dimethyl-1-[(1S,5S,6R,7R)-3-[[3-(2,2,2-trifluoroethyl)phenyl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanamine |
| SMILES | CN(C)C[C@H]1[C@H]2CN(Cc3cccc(CC(F)(F)F)c3)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C20H27F3N2O/c1-24(2)11-16-17-12-25(13-19(17)7-6-18(16)26-19)10-15-5-3-4-14(8-15)9-20(21,22)23/h3-5,8,16-18H,6-7,9-13H2,1-2H3/t16-,17+,18+,19+/m0/s1 |
| InChIKey | TWCIXVMCKPERQG-WJFTUGDTSA-N |
| XLogP | 3.33 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |